C17H22N2O — CID 36804449
1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexan-1-one (PubChem CID 36804449) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexan-1-one.
| Compound Name | 1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 36804449 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)hexan-1-one |
| SMILES | CCCCCC(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C17H22N2O/c1-2-3-4-9-17(20)19-11-10-16-14(12-19)13-7-5-6-8-15(13)18-16/h5-8,18H,2-4,9-12H2,1H3 |
| InChIKey | KYWDTYZLTLLHOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|