C18H24N3O+ — CID 6954140
2-piperidin-1-ium-1-yl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 6954140) has the molecular formula C18H24N3O+ and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-piperidin-1-ium-1-yl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-piperidin-1-ium-1-yl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 6954140 |
| Molecular Formula | C18H24N3O+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-piperidin-1-ium-1-yl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(C[NH+]1CCCCC1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C18H23N3O/c22-18(13-20-9-4-1-5-10-20)21-11-8-17-15(12-21)14-6-2-3-7-16(14)19-17/h2-3,6-7,19H,1,4-5,8-13H2/p+1 |
| InChIKey | UCMSWPOWKRPXIV-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|