C13H14N2O2 — CID 23883966
methyl 1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate (PubChem CID 23883966) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate.
| Compound Name | methyl 1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 23883966 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | methyl 1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxylate |
| SMILES | COC(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C13H14N2O2/c1-17-13(16)15-7-6-12-10(8-15)9-4-2-3-5-11(9)14-12/h2-5,14H,6-8H2,1H3 |
| InChIKey | UOENKVDNLSBLGL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|