C17H22N2O — CID 113089533
1-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-1-one (PubChem CID 113089533) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-1-one.
| Compound Name | 1-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 113089533 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pentan-1-one |
| SMILES | CCCCC(=O)N1CCc2[nH]c3cc(C)ccc3c2C1 |
| InChI | InChI=1S/C17H22N2O/c1-3-4-5-17(20)19-9-8-15-14(11-19)13-7-6-12(2)10-16(13)18-15/h6-7,10,18H,3-5,8-9,11H2,1-2H3 |
| InChIKey | SSSZOAKZHPIUDK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|