C17H16N2OS — CID 113089540
(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-thiophen-2-ylmethanone (PubChem CID 113089540) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is (7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-thiophen-2-ylmethanone.
| Compound Name | (7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 113089540 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-thiophen-2-ylmethanone |
| SMILES | Cc1ccc2c3c([nH]c2c1)CCN(C(=O)c1cccs1)C3 |
| InChI | InChI=1S/C17H16N2OS/c1-11-4-5-12-13-10-19(17(20)16-3-2-8-21-16)7-6-14(13)18-15(12)9-11/h2-5,8-9,18H,6-7,10H2,1H3 |
| InChIKey | AHGQIAODJWBDGE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|