C16H14N2OS — CID 44771350
1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl(thiophen-2-yl)methanone (PubChem CID 44771350) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl(thiophen-2-yl)methanone.
| Compound Name | 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl(thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 44771350 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl(thiophen-2-yl)methanone |
| SMILES | O=C(c1cccs1)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H14N2OS/c19-16(15-6-3-9-20-15)18-8-7-12-11-4-1-2-5-13(11)17-14(12)10-18/h1-6,9,17H,7-8,10H2 |
| InChIKey | FCKRXNJLULJESR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|