C20H18N2O3 — CID 71753330
2-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]benzoic acid (PubChem CID 71753330) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]benzoic acid.
| Compound Name | 2-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 71753330 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CC(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C20H18N2O3/c23-19(11-13-5-1-2-6-14(13)20(24)25)22-10-9-16-15-7-3-4-8-17(15)21-18(16)12-22/h1-8,21H,9-12H2,(H,24,25) |
| InChIKey | PSYUFUHRVIGZST-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|