C13H13N2NaO4S2 — CID 23706000
sodium 2-(2-sulfonatosulfanylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 23706000) has the molecular formula C13H13N2NaO4S2 and a molecular weight of 348.38 g/mol. Its IUPAC name is sodium 2-(2-sulfonatosulfanylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | sodium 2-(2-sulfonatosulfanylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 23706000 |
| Molecular Formula | C13H13N2NaO4S2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | sodium 2-(2-sulfonatosulfanylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | O=C(CSS(=O)(=O)[O-])N1CCc2c([nH]c3ccccc23)C1.[Na+] |
| InChI | InChI=1S/C13H14N2O4S2.Na/c16-13(8-20-21(17,18)19)15-6-5-10-9-3-1-2-4-11(9)14-12(10)7-15;/h1-4,14H,5-8H2,(H,17,18,19);/q;+1/p-1 |
| InChIKey | IZFANFXGKUCSPW-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|