C19H16N4O — CID 141151589
1H-benzimidazol-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone (PubChem CID 141151589) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 1H-benzimidazol-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone.
| Compound Name | 1H-benzimidazol-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 141151589 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1H-benzimidazol-4-yl(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
| SMILES | O=C(c1cccc2[nH]cnc12)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H16N4O/c24-19(14-5-3-7-16-18(14)21-11-20-16)23-9-8-13-12-4-1-2-6-15(12)22-17(13)10-23/h1-7,11,22H,8-10H2,(H,20,21) |
| InChIKey | FPIBRFCJQCGWRL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|