C20H20N2O — CID 113089543
(3-methylphenyl)-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 113089543) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (3-methylphenyl)-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (3-methylphenyl)-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 113089543 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3-methylphenyl)-(7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCc3[nH]c4cc(C)ccc4c3C2)c1 |
| InChI | InChI=1S/C20H20N2O/c1-13-4-3-5-15(10-13)20(23)22-9-8-18-17(12-22)16-7-6-14(2)11-19(16)21-18/h3-7,10-11,21H,8-9,12H2,1-2H3 |
| InChIKey | JDWWXVYXVGGCMJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|