C22H23N3O2 — CID 42931992
3-methyl-N-[1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]benzamide (PubChem CID 42931992) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-methyl-N-[1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]benzamide.
| Compound Name | 3-methyl-N-[1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 42931992 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-methyl-N-[1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)NC(C)C(=O)N2CCc3[nH]c4ccccc4c3C2)c1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-6-5-7-16(12-14)21(26)23-15(2)22(27)25-11-10-20-18(13-25)17-8-3-4-9-19(17)24-20/h3-9,12,15,24H,10-11,13H2,1-2H3,(H,23,26) |
| InChIKey | SXBPTCIZHIVUID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|