C21H23N3O3 — CID 41268134
N-[(2S)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]furan-2-carboxamide (PubChem CID 41268134) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2S)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41268134 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C21H23N3O3/c1-13(2)19(23-20(25)18-8-5-11-27-18)21(26)24-10-9-17-15(12-24)14-6-3-4-7-16(14)22-17/h3-8,11,13,19,22H,9-10,12H2,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | AHOCRRWDMATFKW-IBGZPJMESA-N |
| XLogP | 3.10 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|