C17H27N3O3 — CID 119398584
N-[3-methyl-1-[3-(methylaminomethyl)piperidin-1-yl]-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 119398584) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[3-methyl-1-[3-(methylaminomethyl)piperidin-1-yl]-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-methyl-1-[3-(methylaminomethyl)piperidin-1-yl]-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119398584 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[3-methyl-1-[3-(methylaminomethyl)piperidin-1-yl]-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CNCC1CCCN(C(=O)C(NC(=O)c2ccco2)C(C)C)C1 |
| InChI | InChI=1S/C17H27N3O3/c1-12(2)15(19-16(21)14-7-5-9-23-14)17(22)20-8-4-6-13(11-20)10-18-3/h5,7,9,12-13,15,18H,4,6,8,10-11H2,1-3H3,(H,19,21) |
| InChIKey | AHQUHLNTHULLHT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |