C25H23N3O3 — CID 46700233
N-[1-oxo-3-phenyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]furan-2-carboxamide (PubChem CID 46700233) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[1-oxo-3-phenyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-oxo-3-phenyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46700233 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[1-oxo-3-phenyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)N1CCc2[nH]c3ccccc3c2C1)c1ccco1 |
| InChI | InChI=1S/C25H23N3O3/c29-24(23-11-6-14-31-23)27-22(15-17-7-2-1-3-8-17)25(30)28-13-12-21-19(16-28)18-9-4-5-10-20(18)26-21/h1-11,14,22,26H,12-13,15-16H2,(H,27,29) |
| InChIKey | BUEHZAUFTZBZLV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|