C23H24ClN3O2S — CID 41268322
2-chloro-N-[(2S)-4-methylsulfanyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]benzamide (PubChem CID 41268322) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-4-methylsulfanyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2S)-4-methylsulfanyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 41268322 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-chloro-N-[(2S)-4-methylsulfanyl-1-oxo-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)butan-2-yl]benzamide |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1Cl)C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-30-13-11-21(26-22(28)16-7-2-4-8-18(16)24)23(29)27-12-10-20-17(14-27)15-6-3-5-9-19(15)25-20/h2-9,21,25H,10-14H2,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | QCKYJMRZNANLGG-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|