C18H23ClN2O4S — CID 119167659
1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxylic acid (PubChem CID 119167659) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119167659 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxylic acid |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C18H23ClN2O4S/c1-26-10-8-15(20-16(22)13-6-2-3-7-14(13)19)17(23)21-9-4-5-12(11-21)18(24)25/h2-3,6-7,12,15H,4-5,8-11H2,1H3,(H,20,22)(H,24,25) |
| InChIKey | ZSOILUBBZHFWHH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |