C22H32ClN3O4S — CID 55953683
1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55953683) has the molecular formula C22H32ClN3O4S and a molecular weight of 470.04 g/mol. Its IUPAC name is 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55953683 |
| Molecular Formula | C22H32ClN3O4S |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-[2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)C(CCSC)NC(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H32ClN3O4S/c1-30-14-5-11-24-20(27)16-8-12-26(13-9-16)22(29)19(10-15-31-2)25-21(28)17-6-3-4-7-18(17)23/h3-4,6-7,16,19H,5,8-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | DVAQUBZJXPNRQB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|