C21H29Cl2N3O3S — CID 55855311
2,4-dichloro-N-[1-[2-(cyclohexanecarbonylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 55855311) has the molecular formula C21H29Cl2N3O3S and a molecular weight of 474.45 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(cyclohexanecarbonylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(cyclohexanecarbonylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55855311 |
| Molecular Formula | C21H29Cl2N3O3S |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(cyclohexanecarbonylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H29Cl2N3O3S/c1-30-12-9-18(26-20(28)16-8-7-15(22)13-17(16)23)21(29)25-11-10-24-19(27)14-5-3-2-4-6-14/h7-8,13-14,18H,2-6,9-12H2,1H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | KRXMBNLXLXONHN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|