C15H21Cl2N3O2S — CID 119503436
2,4-dichloro-N-[1-[2-(methylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 119503436) has the molecular formula C15H21Cl2N3O2S and a molecular weight of 378.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(methylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(methylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 119503436 |
| Molecular Formula | C15H21Cl2N3O2S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(methylamino)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CNCCNC(=O)C(CCSC)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O2S/c1-18-6-7-19-15(22)13(5-8-23-2)20-14(21)11-4-3-10(16)9-12(11)17/h3-4,9,13,18H,5-8H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | HLGNCUGHZWVHGQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|