C21H22Cl2N2O5S — CID 55847460
N-[1-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 55847460) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is N-[1-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 55847460 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-[1-[2-(1,3-benzodioxol-5-yloxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CSCCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22Cl2N2O5S/c1-31-9-6-17(25-20(26)15-4-2-13(22)10-16(15)23)21(27)24-7-8-28-14-3-5-18-19(11-14)30-12-29-18/h2-5,10-11,17H,6-9,12H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | CMSIBYCCDGPCPD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|