C21H21Cl2N3O5S — CID 55454671
2,4-dichloro-N-[1-[2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 55454671) has the molecular formula C21H21Cl2N3O5S and a molecular weight of 498.39 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55454671 |
| Molecular Formula | C21H21Cl2N3O5S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H21Cl2N3O5S/c1-32-9-6-16(24-20(28)14-4-3-13(22)11-15(14)23)21(29)26-25-19(27)12-2-5-17-18(10-12)31-8-7-30-17/h2-5,10-11,16H,6-9H2,1H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | FGNCJCMBKXLOAZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|