C18H19N3O6S — CID 7987574
N-[(2R)-1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 7987574) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is N-[(2R)-1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7987574 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(2R)-1-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccco1)C(=O)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19N3O6S/c1-28-8-6-12(19-18(24)14-3-2-7-25-14)17(23)21-20-16(22)11-4-5-13-15(9-11)27-10-26-13/h2-5,7,9,12H,6,8,10H2,1H3,(H,19,24)(H,20,22)(H,21,23)/t12-/m1/s1 |
| InChIKey | SSPMJIXMHBNJBB-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|