C15H17N5O4S — CID 24618554
N-[4-methylsulfanyl-1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide (PubChem CID 24618554) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24618554 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-[2-(pyrazine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
| SMILES | CSCCC(NC(=O)c1ccco1)C(=O)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C15H17N5O4S/c1-25-8-4-10(18-15(23)12-3-2-7-24-12)13(21)19-20-14(22)11-9-16-5-6-17-11/h2-3,5-7,9-10H,4,8H2,1H3,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | ADLUDQIOTSBKTN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|