C16H22N4O3S — CID 37393255
N-[(2R)-4-methylsulfanyl-1-oxo-1-(3-pyrazol-1-ylpropylamino)butan-2-yl]furan-2-carboxamide (PubChem CID 37393255) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(2R)-4-methylsulfanyl-1-oxo-1-(3-pyrazol-1-ylpropylamino)butan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-4-methylsulfanyl-1-oxo-1-(3-pyrazol-1-ylpropylamino)butan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 37393255 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[(2R)-4-methylsulfanyl-1-oxo-1-(3-pyrazol-1-ylpropylamino)butan-2-yl]furan-2-carboxamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccco1)C(=O)NCCCn1cccn1 |
| InChI | InChI=1S/C16H22N4O3S/c1-24-12-6-13(19-16(22)14-5-2-11-23-14)15(21)17-7-3-9-20-10-4-8-18-20/h2,4-5,8,10-11,13H,3,6-7,9,12H2,1H3,(H,17,21)(H,19,22)/t13-/m1/s1 |
| InChIKey | RQNJJPBRXHTMNE-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|