C16H18N4O4S — CID 27662277
N-[(2R)-4-methylsulfanyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide (PubChem CID 27662277) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[(2R)-4-methylsulfanyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-4-methylsulfanyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27662277 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[(2R)-4-methylsulfanyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccco1)C(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C16H18N4O4S/c1-25-10-7-12(18-16(23)13-6-4-9-24-13)15(22)20-19-14(21)11-5-2-3-8-17-11/h2-6,8-9,12H,7,10H2,1H3,(H,18,23)(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | XFFHCCAQVGWWTP-GFCCVEGCSA-N |
| XLogP | 0.99 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|