C18H20FN3O4S2 — CID 26615693
N-[(2R)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 26615693) has the molecular formula C18H20FN3O4S2 and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[(2R)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26615693 |
| Molecular Formula | C18H20FN3O4S2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-[(2R)-1-[2-[2-(2-fluorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CSCC[C@@H](NC(=O)c1ccco1)C(=O)NNC(=O)CSc1ccccc1F |
| InChI | InChI=1S/C18H20FN3O4S2/c1-27-10-8-13(20-18(25)14-6-4-9-26-14)17(24)22-21-16(23)11-28-15-7-3-2-5-12(15)19/h2-7,9,13H,8,10-11H2,1H3,(H,20,25)(H,21,23)(H,22,24)/t13-/m1/s1 |
| InChIKey | AEDWLVIDMPHAGA-CYBMUJFWSA-N |
| XLogP | 2.21 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|