C20H21N5O4S — CID 24541020
N-[4-methylsulfanyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide (PubChem CID 24541020) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24541020 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]butan-2-yl]furan-2-carboxamide |
| SMILES | CSCCC(NC(=O)c1ccco1)C(=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H21N5O4S/c1-30-11-9-14(21-20(28)17-8-5-10-29-17)18(26)24-25-19(27)16-12-15(22-23-16)13-6-3-2-4-7-13/h2-8,10,12,14H,9,11H2,1H3,(H,21,28)(H,22,23)(H,24,26)(H,25,27) |
| InChIKey | XRLLHUULDCKFQY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|