C14H16N4O2S — CID 18164415
N'-(3-methylsulfanylpropanoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 18164415) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N'-(3-methylsulfanylpropanoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(3-methylsulfanylpropanoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 18164415 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N'-(3-methylsulfanylpropanoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | CSCCC(=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C14H16N4O2S/c1-21-8-7-13(19)17-18-14(20)12-9-11(15-16-12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,15,16)(H,17,19)(H,18,20) |
| InChIKey | ZPFAFXWUIFZLAX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|