C13H14N4O2 — CID 2677236
3-phenyl-N'-propanoyl-1H-pyrazole-5-carbohydrazide (PubChem CID 2677236) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-phenyl-N'-propanoyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-propanoyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2677236 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-phenyl-N'-propanoyl-1H-pyrazole-5-carbohydrazide |
| SMILES | CCC(=O)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H14N4O2/c1-2-12(18)16-17-13(19)11-8-10(14-15-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,14,15)(H,16,18)(H,17,19) |
| InChIKey | UWJOHBLUGFJQOY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|