C19H16BrN5O3 — CID 35945015
4-bromo-N-[2-oxo-2-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]ethyl]benzamide (PubChem CID 35945015) has the molecular formula C19H16BrN5O3 and a molecular weight of 442.27 g/mol. Its IUPAC name is 4-bromo-N-[2-oxo-2-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-oxo-2-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 35945015 |
| Molecular Formula | C19H16BrN5O3 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 4-bromo-N-[2-oxo-2-[2-(3-phenyl-1H-pyrazole-5-carbonyl)hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H16BrN5O3/c20-14-8-6-13(7-9-14)18(27)21-11-17(26)24-25-19(28)16-10-15(22-23-16)12-4-2-1-3-5-12/h1-10H,11H2,(H,21,27)(H,22,23)(H,24,26)(H,25,28) |
| InChIKey | XBMOKPZBSQKAFW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|