C17H14N4O3 — CID 27698464
N'-(2-hydroxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 27698464) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is N'-(2-hydroxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(2-hydroxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27698464 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N'-(2-hydroxybenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H14N4O3/c22-15-9-5-4-8-12(15)16(23)20-21-17(24)14-10-13(18-19-14)11-6-2-1-3-7-11/h1-10,22H,(H,18,19)(H,20,23)(H,21,24) |
| InChIKey | XVGRXAOJXNFGAU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|