C17H16N4O2S — CID 17486234
N'-(2,5-dimethylthiophene-3-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 17486234) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N'-(2,5-dimethylthiophene-3-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(2,5-dimethylthiophene-3-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 17486234 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N'-(2,5-dimethylthiophene-3-carbonyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)c(C)s1 |
| InChI | InChI=1S/C17H16N4O2S/c1-10-8-13(11(2)24-10)16(22)20-21-17(23)15-9-14(18-19-15)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,18,19)(H,20,22)(H,21,23) |
| InChIKey | CEMSBFAMCCBYPN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|