C15H12N4O2S — CID 40671857
3-phenyl-N'-(thiophene-3-carbonyl)-1H-pyrazole-5-carbohydrazide (PubChem CID 40671857) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-phenyl-N'-(thiophene-3-carbonyl)-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-(thiophene-3-carbonyl)-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 40671857 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-phenyl-N'-(thiophene-3-carbonyl)-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)n[nH]1)c1ccsc1 |
| InChI | InChI=1S/C15H12N4O2S/c20-14(11-6-7-22-9-11)18-19-15(21)13-8-12(16-17-13)10-4-2-1-3-5-10/h1-9H,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | GOJFYONBZLBODP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|