C21H19N5O3 — CID 26823723
N-[4-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 26823723) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[4-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 26823723 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[4-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)n[nH]1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H19N5O3/c27-19(14-6-7-14)22-16-10-8-15(9-11-16)20(28)25-26-21(29)18-12-17(23-24-18)13-4-2-1-3-5-13/h1-5,8-12,14H,6-7H2,(H,22,27)(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | CBOITYJXAQIUIL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|