C18H15Cl2N3O3 — CID 17133633
N-[4-[[(3,5-dichlorobenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 17133633) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is N-[4-[[(3,5-dichlorobenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(3,5-dichlorobenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 17133633 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[4-[[(3,5-dichlorobenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(NNC(=O)c1cc(Cl)cc(Cl)c1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-13-7-12(8-14(20)9-13)18(26)23-22-17(25)11-3-5-15(6-4-11)21-16(24)10-1-2-10/h3-10H,1-2H2,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | CIWBGJPJPGZSFS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|