C20H20ClN3O3 — CID 17179166
N-[4-[[3-(2-chlorophenyl)propanoylamino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 17179166) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[4-[[3-(2-chlorophenyl)propanoylamino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[3-(2-chlorophenyl)propanoylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 17179166 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[4-[[3-(2-chlorophenyl)propanoylamino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCc1ccccc1Cl)NNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-17-4-2-1-3-13(17)9-12-18(25)23-24-20(27)15-7-10-16(11-8-15)22-19(26)14-5-6-14/h1-4,7-8,10-11,14H,5-6,9,12H2,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | UGXVQKKCLYIQGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|