C19H19FN2O2 — CID 41266031
N-[4-[3-(2-fluorophenyl)propanoylamino]phenyl]cyclopropanecarboxamide (PubChem CID 41266031) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is N-[4-[3-(2-fluorophenyl)propanoylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[3-(2-fluorophenyl)propanoylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 41266031 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[4-[3-(2-fluorophenyl)propanoylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCc1ccccc1F)Nc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H19FN2O2/c20-17-4-2-1-3-13(17)7-12-18(23)21-15-8-10-16(11-9-15)22-19(24)14-5-6-14/h1-4,8-11,14H,5-7,12H2,(H,21,23)(H,22,24) |
| InChIKey | HJLVCBHSQIHZCP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |