C24H21N3O3 — CID 4507519
N-[4-[[(4-phenylbenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 4507519) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[4-[[(4-phenylbenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[(4-phenylbenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 4507519 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[4-[[(4-phenylbenzoyl)amino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(NNC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C24H21N3O3/c28-22(18-10-11-18)25-21-14-12-20(13-15-21)24(30)27-26-23(29)19-8-6-17(7-9-19)16-4-2-1-3-5-16/h1-9,12-15,18H,10-11H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | RYCWOFFAPMYWAT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|