C20H18ClN3O3 — CID 17195599
N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 17195599) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 17195599 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H18ClN3O3/c21-16-8-1-13(2-9-16)3-12-18(25)23-24-20(27)15-6-10-17(11-7-15)22-19(26)14-4-5-14/h1-3,6-12,14H,4-5H2,(H,22,26)(H,23,25)(H,24,27)/b12-3+ |
| InChIKey | HXFXHBGBKDYYMI-KGVSQERTSA-N |
| XLogP | 3.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|