C23H24N4O5 — CID 17176112
N-[4-[[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 17176112) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[4-[[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17176112 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[4-[[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NNC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H24N4O5/c28-21(14-9-16-5-4-8-20(15-16)27(31)32)25-26-23(30)18-10-12-19(13-11-18)24-22(29)17-6-2-1-3-7-17/h4-5,8-15,17H,1-3,6-7H2,(H,24,29)(H,25,28)(H,26,30)/b14-9+ |
| InChIKey | KLDUGFYLTIOAEY-NTEUORMPSA-N |
| XLogP | 3.59 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|