C16H13ClN2O2 — CID 959776
4-chloro-N'-[(E)-3-phenylprop-2-enoyl]benzohydrazide (PubChem CID 959776) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 4-chloro-N'-[(E)-3-phenylprop-2-enoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[(E)-3-phenylprop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 959776 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-chloro-N'-[(E)-3-phenylprop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1ccccc1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O2/c17-14-9-7-13(8-10-14)16(21)19-18-15(20)11-6-12-4-2-1-3-5-12/h1-11H,(H,18,20)(H,19,21)/b11-6+ |
| InChIKey | VAWODOLMIKQVOZ-IZZDOVSWSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|