C14H11ClN2O2S — CID 922928
4-chloro-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide (PubChem CID 922928) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is 4-chloro-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 922928 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 4-chloro-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1cccs1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClN2O2S/c15-11-5-3-10(4-6-11)14(19)17-16-13(18)8-7-12-2-1-9-20-12/h1-9H,(H,16,18)(H,17,19)/b8-7+ |
| InChIKey | KWNWXDKCTKHNQE-BQYQJAHWSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|