C19H22N2O4S — CID 9440087
4-butoxy-3-methoxy-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide (PubChem CID 9440087) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide.
| Compound Name | 4-butoxy-3-methoxy-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9440087 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-butoxy-3-methoxy-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)/C=C/c2cccs2)cc1OC |
| InChI | InChI=1S/C19H22N2O4S/c1-3-4-11-25-16-9-7-14(13-17(16)24-2)19(23)21-20-18(22)10-8-15-6-5-12-26-15/h5-10,12-13H,3-4,11H2,1-2H3,(H,20,22)(H,21,23)/b10-8+ |
| InChIKey | ZYKTXAGFLQNYTP-CSKARUKUSA-N |
| XLogP | 3.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|