C21H23FN2O4 — CID 9440084
4-butoxy-N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-methoxybenzohydrazide (PubChem CID 9440084) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 4-butoxy-N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-methoxybenzohydrazide.
| Compound Name | 4-butoxy-N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9440084 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4-butoxy-N'-[(E)-3-(3-fluorophenyl)prop-2-enoyl]-3-methoxybenzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)/C=C/c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C21H23FN2O4/c1-3-4-12-28-18-10-9-16(14-19(18)27-2)21(26)24-23-20(25)11-8-15-6-5-7-17(22)13-15/h5-11,13-14H,3-4,12H2,1-2H3,(H,23,25)(H,24,26)/b11-8+ |
| InChIKey | ALQWCKOMWNEQNV-DHZHZOJOSA-N |
| XLogP | 3.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|