C18H16N4O2 — CID 26823847
N'-(3-methylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 26823847) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is N'-(3-methylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-(3-methylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26823847 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N'-(3-methylbenzoyl)-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | Cc1cccc(C(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C18H16N4O2/c1-12-6-5-9-14(10-12)17(23)21-22-18(24)16-11-15(19-20-16)13-7-3-2-4-8-13/h2-11H,1H3,(H,19,20)(H,21,23)(H,22,24) |
| InChIKey | YTJYYTONTMXSOX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|