C23H19N5O4S — CID 27689349
N-[3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 27689349) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27689349 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)n[nH]1)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19N5O4S/c29-22(26-27-23(30)21-15-20(24-25-21)16-8-3-1-4-9-16)17-10-7-11-18(14-17)28-33(31,32)19-12-5-2-6-13-19/h1-15,28H,(H,24,25)(H,26,29)(H,27,30) |
| InChIKey | GGOVEOCHBAIZKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|