C20H16N6O3S — CID 118947524
3-phenyl-N-[3-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 118947524) has the molecular formula C20H16N6O3S and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-phenyl-N-[3-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-phenyl-N-[3-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118947524 |
| Molecular Formula | C20H16N6O3S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-phenyl-N-[3-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ncccn2)c1)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H16N6O3S/c27-19(18-13-17(24-25-18)14-6-2-1-3-7-14)23-15-8-4-9-16(12-15)30(28,29)26-20-21-10-5-11-22-20/h1-13H,(H,23,27)(H,24,25)(H,21,22,26) |
| InChIKey | DKJHEAXETHNWHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |