C24H21N5O4S — CID 24502761
N-benzyl-3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 24502761) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-benzyl-3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24502761 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-benzyl-3-[[(3-phenyl-1H-pyrazole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)n[nH]1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C24H21N5O4S/c30-23(28-29-24(31)22-15-21(26-27-22)18-10-5-2-6-11-18)19-12-7-13-20(14-19)34(32,33)25-16-17-8-3-1-4-9-17/h1-15,25H,16H2,(H,26,27)(H,28,30)(H,29,31) |
| InChIKey | YVJPUXUTVQDPQK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|