C25H24N4O4S — CID 26826505
N-benzyl-3-[[(2,3-dimethyl-1H-indole-5-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 26826505) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-benzyl-3-[[(2,3-dimethyl-1H-indole-5-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[[(2,3-dimethyl-1H-indole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26826505 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-benzyl-3-[[(2,3-dimethyl-1H-indole-5-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NNC(=O)c3cccc(S(=O)(=O)NCc4ccccc4)c3)cc2c1C |
| InChI | InChI=1S/C25H24N4O4S/c1-16-17(2)27-23-12-11-20(14-22(16)23)25(31)29-28-24(30)19-9-6-10-21(13-19)34(32,33)26-15-18-7-4-3-5-8-18/h3-14,26-27H,15H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | YZJIXUWVUYSHGU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|