C23H24N4O6S — CID 27690183
methyl 5-[[[3-(benzylsulfamoyl)benzoyl]amino]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 27690183) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is methyl 5-[[[3-(benzylsulfamoyl)benzoyl]amino]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[[[3-(benzylsulfamoyl)benzoyl]amino]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 27690183 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | methyl 5-[[[3-(benzylsulfamoyl)benzoyl]amino]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)NNC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)c1C |
| InChI | InChI=1S/C23H24N4O6S/c1-14-19(23(30)33-3)15(2)25-20(14)22(29)27-26-21(28)17-10-7-11-18(12-17)34(31,32)24-13-16-8-5-4-6-9-16/h4-12,24-25H,13H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | XENPCFOWJURCJT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|